CAS 130874-32-7 is the registry number for 1-Benzenesulfonyl-4-bromo-3,5-dimethyl-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(benzenesulfonyl)-4-bromo-3,5-dimethylpyrazole (CAS 130874-32-7) is a chemical compound with the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-bromo-3,5-dimethylpyrazole. InChIKey: ZIUFRYBNFVJNFI-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2S |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-bromo-3,5-dimethylpyrazole |
| InChIKey | ZIUFRYBNFVJNFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1S(=O)(=O)C2=CC=CC=C2)C)Br |
Computed by PubChem (NCBI)