Products 2657652-96-3
CAS 2657652-96-3 is the registry number for 3-(5-Bromo-3-methyl-1H-indazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-bromo-3-methylindazol-1-yl)thietane 1,1-dioxide (CAS 2657652-96-3) is a chemical compound with the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. IUPAC name: 3-(5-bromo-3-methylindazol-1-yl)thietane 1,1-dioxide. InChIKey: OROMHOLUJKATAA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2S |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | 3-(5-bromo-3-methylindazol-1-yl)thietane 1,1-dioxide |
| InChIKey | OROMHOLUJKATAA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=C2)Br)C3CS(=O)(=O)C3 |
Computed by PubChem (NCBI)