CAS 119768-80-8 is the registry number for 4-(tert-Butyl) 1-methyl (S)-3-((tert-butoxycarbonyl)amino)-2,2-dimethylsuccinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-O-tert-butyl 1-O-methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 119768-80-8) is a chemical compound with the molecular formula C16H29NO6 and a molecular weight of 331.40 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: BBMWUBAPPNJDCS-UHFFFAOYSA-N.
| Molecular formula | C16H29NO6 |
|---|---|
| Molecular weight | 331.40 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | BBMWUBAPPNJDCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C(C)(C)C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)