Products 74536-37-1
CAS 74536-37-1 is the registry number for 1,3-Di-tert-butyl 2-{((tert-butoxy)carbonyl)amino}propanedioate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (CAS 74536-37-1) is a chemical compound with the molecular formula C16H29NO6 and a molecular weight of 331.40 g/mol. IUPAC name: ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate. InChIKey: GTDSAKXEUNWFCR-UHFFFAOYSA-N.
| Molecular formula | C16H29NO6 |
|---|---|
| Molecular weight | 331.40 g/mol |
| IUPAC name | ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| InChIKey | GTDSAKXEUNWFCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)