Products 73538-32-6

CAS 73538-32-6 is the registry number for gamma-Carboxyglutamic Acid gamma,gamma-Di-t-butyl 3-Ethyl Ester. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

1-O,1-O-ditert-butyl 3-O-ethyl 3-aminopropane-1,1,3-tricarboxylate (CAS 73538-32-6) is a chemical compound with the molecular formula C16H29NO6 and a molecular weight of 331.40 g/mol. IUPAC name: 1-O,1-O-ditert-butyl 3-O-ethyl 3-aminopropane-1,1,3-tricarboxylate. InChIKey: WFLNMRHMSASNEO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H29NO6
Molecular weight331.40 g/mol
IUPAC name1-O,1-O-ditert-butyl 3-O-ethyl 3-aminopropane-1,1,3-tricarboxylate
InChIKeyWFLNMRHMSASNEO-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N

Computed by PubChem (NCBI)