Products 1197683-35-4
CAS 1197683-35-4 is the registry number for 3-(3,4-Dihydro-2H-1,4-benzoxazine-4-sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)benzoic acid (CAS 1197683-35-4) is a chemical compound with the molecular formula C15H13NO5S and a molecular weight of 319.3 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)benzoic acid. InChIKey: JHRNSSLCEKQNNW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5S |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)benzoic acid |
| InChIKey | JHRNSSLCEKQNNW-UHFFFAOYSA-N |
| SMILES | C1COC2=CC=CC=C2N1S(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)