Products 2764598-01-6
CAS 2764598-01-6 appears in our catalog under these names: MMP2–IN–1, MMP2-IN-1, 99.24%, MMP2-IN-1, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 50 mg, 5 mg, 10 mg, 25 mg, 100 mg.
4-(4-methylphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]deca-6,9-diene-3,8-dione (CAS 2764598-01-6) is a chemical compound with the molecular formula C15H13NO5S and a molecular weight of 319.3 g/mol. IUPAC name: 4-(4-methylphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]deca-6,9-diene-3,8-dione. InChIKey: XXJKWYKORAOIFE-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5S |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 4-(4-methylphenyl)sulfonyl-1-oxa-4-azaspiro[4.5]deca-6,9-diene-3,8-dione |
| InChIKey | XXJKWYKORAOIFE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(=O)COC23C=CC(=O)C=C3 |
Computed by PubChem (NCBI)