Products 1197710-93-2
CAS 1197710-93-2 is the registry number for 2-Acetamido-N-(tert-butyl)thiazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-acetamido-N-tert-butyl-1,3-thiazole-4-carboxamide (CAS 1197710-93-2) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: 2-acetamido-N-tert-butyl-1,3-thiazole-4-carboxamide. InChIKey: MFFGANQIXGMIND-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 2-acetamido-N-tert-butyl-1,3-thiazole-4-carboxamide |
| InChIKey | MFFGANQIXGMIND-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=CS1)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)