CAS 1197803-27-2 is the registry number for 4-(4,5-Dichloro-1-methyl-1H-pyrrole-2-carbonyl)piperazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,5-dichloro-1-methylpyrrole-2-carbonyl)piperazin-2-one (CAS 1197803-27-2) is a chemical compound with the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. IUPAC name: 4-(4,5-dichloro-1-methylpyrrole-2-carbonyl)piperazin-2-one. InChIKey: ULKSEZALRKCVSA-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O2 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 4-(4,5-dichloro-1-methylpyrrole-2-carbonyl)piperazin-2-one |
| InChIKey | ULKSEZALRKCVSA-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=C1Cl)Cl)C(=O)N2CCNC(=O)C2 |
Computed by PubChem (NCBI)