Products 1555698-54-8
CAS 1555698-54-8 is the registry number for 1-(3,6-Dichloro-4-pyridazinyl)piperidine-3-carboxylic Acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3,6-dichloropyridazin-4-yl)piperidine-3-carboxylic acid (CAS 1555698-54-8) is a chemical compound with the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. IUPAC name: 1-(3,6-dichloropyridazin-4-yl)piperidine-3-carboxylic acid. InChIKey: VKFMSOFPLVUBCS-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O2 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 1-(3,6-dichloropyridazin-4-yl)piperidine-3-carboxylic acid |
| InChIKey | VKFMSOFPLVUBCS-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC(=NN=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)