Products 98187-86-1
CAS 98187-86-1 is the registry number for 2,2-Dichloro-N-(4-(hydrazinecarbonyl)benzyl)acetamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dichloro-N-[[4-(hydrazinecarbonyl)phenyl]methyl]acetamide (CAS 98187-86-1) is a chemical compound with the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. IUPAC name: 2,2-dichloro-N-[[4-(hydrazinecarbonyl)phenyl]methyl]acetamide. InChIKey: CRGLCJMXBGXUSZ-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N3O2 |
|---|---|
| Molecular weight | 276.12 g/mol |
| IUPAC name | 2,2-dichloro-N-[[4-(hydrazinecarbonyl)phenyl]methyl]acetamide |
| InChIKey | CRGLCJMXBGXUSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)C(Cl)Cl)C(=O)NN |
Computed by PubChem (NCBI)