Products 1198-57-8
CAS 1198-57-8 appears in our catalog under these names: 1,2,4,5-Tetrachlorobenzene-d2, 98 atom % D, min 98% Chemical Purity, 1,2,4,5-Tetrachlorobenzene (d2), >95% (HPLC). Offered by: CDN, TRC. Available pack sizes: 0,5g, 0,25g, 100mg, 500mg, 50mg.
1,2,4,5-tetrachloro-3,6-dideuteriobenzene (CAS 1198-57-8) is a chemical compound with the molecular formula C6H2Cl4 and a molecular weight of 217.9 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3,6-dideuteriobenzene. InChIKey: JHBKHLUZVFWLAG-QDNHWIQGSA-N.
| Molecular formula | C6H2Cl4 |
|---|---|
| Molecular weight | 217.9 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3,6-dideuteriobenzene |
| InChIKey | JHBKHLUZVFWLAG-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)Cl)[2H])Cl)Cl |
Computed by PubChem (NCBI)