CAS 85380-73-0 appears in our catalog under these names: 1,2,4,5-Tetrachlorobenzene 13C6 100 μg/mL in Acetonitrile, 1,2,4,5-Tetrachlorobenzene-13C6. Offered by: Dr. Ehrenstorfer, TRC. Available pack sizes: 1ml, 5mg.
1,2,4,5-tetrachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 85380-73-0) is a chemical compound with the molecular formula C6H2Cl4 and a molecular weight of 221.8 g/mol. IUPAC name: 1,2,4,5-tetrachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: JHBKHLUZVFWLAG-IDEBNGHGSA-N.
| Molecular formula | C6H2Cl4 |
|---|---|
| Molecular weight | 221.8 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | JHBKHLUZVFWLAG-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13CH][13C](=[13C]1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)