CAS 2199-73-7 appears in our catalog under these names: 1,2,3,4-Tetrachlorobenzene-d2, 98 atom % D, min 98% Chemical Purity, 1,2,3,4-Tetrachlorobenzene-d2. Offered by: CDN, TRC. Available pack sizes: 0,5g, 0,25g, 10mg, 50mg, 5mg.
1,2,3,4-tetrachloro-5,6-dideuteriobenzene (CAS 2199-73-7) is a chemical compound with the molecular formula C6H2Cl4 and a molecular weight of 217.9 g/mol. IUPAC name: 1,2,3,4-tetrachloro-5,6-dideuteriobenzene. InChIKey: GBDZXPJXOMHESU-QDNHWIQGSA-N.
| Molecular formula | C6H2Cl4 |
|---|---|
| Molecular weight | 217.9 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5,6-dideuteriobenzene |
| InChIKey | GBDZXPJXOMHESU-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)[2H] |
Computed by PubChem (NCBI)