CAS 119804-96-5 appears in our catalog under these names: Sofosbuvir Impurity 123, DMDC. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one (CAS 119804-96-5) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one. InChIKey: PULHLIOPJXPGJN-BWVDBABLSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidin-2-one |
| InChIKey | PULHLIOPJXPGJN-BWVDBABLSA-N |
| SMILES | C=C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)CO)O |
Computed by PubChem (NCBI)