CAS 119807-84-0 appears in our catalog under these names: (R)-(+)-2-Benzylsuccinic acid 1-methyl ester, 95%, (R)–3–Benzyl–4–methoxy–4–oxobutanoic acid, (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid, 95%, 95%, (R)-3-Benzyl-4-methoxy-4-oxobutanoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-benzyl-4-methoxy-4-oxobutanoic acid (CAS 119807-84-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (3R)-3-benzyl-4-methoxy-4-oxobutanoic acid. InChIKey: BUNMUVFKMIOEQU-SNVBAGLBSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (3R)-3-benzyl-4-methoxy-4-oxobutanoic acid |
| InChIKey | BUNMUVFKMIOEQU-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)CC(=O)O |
Computed by PubChem (NCBI)