Products 182247-45-6
CAS 182247-45-6 appears in our catalog under these names: (S)-(-)-2-Benzylsuccinic acid 1-methyl ester, 95%, Mitiglinide Impurity 15, (S)-3-Benzyl-4-methoxy-4-oxobutanoic acid 95%, (S)-3-Benzyl-4-methoxy-4-oxobutanoic acid, 95%, 95%, (S)-3-benzyl-4-methoxy-4-oxobutanoic acid, 98%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, on request.
(3S)-3-benzyl-4-methoxy-4-oxobutanoic acid (CAS 182247-45-6) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (3S)-3-benzyl-4-methoxy-4-oxobutanoic acid. InChIKey: BUNMUVFKMIOEQU-JTQLQIEISA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (3S)-3-benzyl-4-methoxy-4-oxobutanoic acid |
| InChIKey | BUNMUVFKMIOEQU-JTQLQIEISA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1)CC(=O)O |
Computed by PubChem (NCBI)