Products 1198084-45-5
CAS 1198084-45-5 is the registry number for 4-(Benzylthio)-3-methyl-1,2,5-oxadiazole 2-Oxide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-benzylsulfanyl-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium (CAS 1198084-45-5) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 4-benzylsulfanyl-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium. InChIKey: OQLJEGUMMQYLCR-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 4-benzylsulfanyl-3-methyl-2-oxido-1,2,5-oxadiazol-2-ium |
| InChIKey | OQLJEGUMMQYLCR-UHFFFAOYSA-N |
| SMILES | CC1=[N+](ON=C1SCC2=CC=CC=C2)[O-] |
Computed by PubChem (NCBI)