Products 1198117-30-4
CAS 1198117-30-4 is the registry number for 5-(3,5-Dimethylphenylamino)-2-methylphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
5-(3,5-dimethylanilino)-2-methylphenol (CAS 1198117-30-4) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: 5-(3,5-dimethylanilino)-2-methylphenol. InChIKey: LMHQFKNVCUEZBR-UHFFFAOYSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | 5-(3,5-dimethylanilino)-2-methylphenol |
| InChIKey | LMHQFKNVCUEZBR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=CC(=CC(=C2)C)C)O |
Computed by PubChem (NCBI)