CAS 1198117-78-0 is the registry number for 4-((3,5-Dimethylphenyl)amino)-2-methylphenol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
4-(3,5-dimethylanilino)-2-methylphenol (CAS 1198117-78-0) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: 4-(3,5-dimethylanilino)-2-methylphenol. InChIKey: SVERQACUTREAOP-UHFFFAOYSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | 4-(3,5-dimethylanilino)-2-methylphenol |
| InChIKey | SVERQACUTREAOP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC2=CC(=C(C=C2)O)C)C |
Computed by PubChem (NCBI)