CAS 1198154-31-2 appears in our catalog under these names: 3,4-Dihydro-2h-[1,4]oxazino[3,2-c]quinoline, 95%, 3,4-Dihydro-2H-[1,4]oxazino[3,2-c]quinoline, ≥97%, ≥97%, 3,4-DIHYDRO-2H-[1,4]OXAZINO[3,2-C]QUINOLINE, ≥97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
3,4-dihydro-2H-[1,4]oxazino[3,2-c]quinoline (CAS 1198154-31-2) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 3,4-dihydro-2H-[1,4]oxazino[3,2-c]quinoline. InChIKey: QYBBZRJXSQWQHO-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 3,4-dihydro-2H-[1,4]oxazino[3,2-c]quinoline |
| InChIKey | QYBBZRJXSQWQHO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=NC3=CC=CC=C32 |
Computed by PubChem (NCBI)