Products 119818-52-9
CAS 119818-52-9 is the registry number for 2',3'-Dideoxy-C(Ac). Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (CAS 119818-52-9) is a chemical compound with the molecular formula C11H15N3O4 and a molecular weight of 253.25 g/mol. IUPAC name: N-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide. InChIKey: ZFDZWMCMWRPWDU-WCBMZHEXSA-N.
| Molecular formula | C11H15N3O4 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | N-[1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| InChIKey | ZFDZWMCMWRPWDU-WCBMZHEXSA-N |
| SMILES | CC(=O)NC1=NC(=O)N(C=C1)[C@H]2CC[C@H](O2)CO |
Computed by PubChem (NCBI)