Products 1198596-96-1

CAS 1198596-96-1 is the registry number for 4,5-Dimethylthiazole-2-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4,5-dimethyl-1,3-thiazole-2-sulfonyl chloride (CAS 1198596-96-1) is a chemical compound with the molecular formula C5H6ClNO2S2 and a molecular weight of 211.7 g/mol. IUPAC name: 4,5-dimethyl-1,3-thiazole-2-sulfonyl chloride. InChIKey: PUYFKWWIISMRCT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6ClNO2S2
Molecular weight211.7 g/mol
IUPAC name4,5-dimethyl-1,3-thiazole-2-sulfonyl chloride
InChIKeyPUYFKWWIISMRCT-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)