CAS 1198596-96-1 is the registry number for 4,5-Dimethylthiazole-2-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dimethyl-1,3-thiazole-2-sulfonyl chloride (CAS 1198596-96-1) is a chemical compound with the molecular formula C5H6ClNO2S2 and a molecular weight of 211.7 g/mol. IUPAC name: 4,5-dimethyl-1,3-thiazole-2-sulfonyl chloride. InChIKey: PUYFKWWIISMRCT-UHFFFAOYSA-N.
| Molecular formula | C5H6ClNO2S2 |
|---|---|
| Molecular weight | 211.7 g/mol |
| IUPAC name | 4,5-dimethyl-1,3-thiazole-2-sulfonyl chloride |
| InChIKey | PUYFKWWIISMRCT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)