CAS 80466-80-4 appears in our catalog under these names: 2,4-Dimethyl-1,3-thiazole-5-sulfonyl chloride, 97%, 2,4-Dimethyl-1,3-thiazole-5-sulfonylchloride, 97%, 2,4-Dimethylthiazole-5-sulfonyl chloride, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 500mg, 2.5g.
2,4-dimethyl-1,3-thiazole-5-sulfonyl chloride (CAS 80466-80-4) is a chemical compound with the molecular formula C5H6ClNO2S2 and a molecular weight of 211.7 g/mol. IUPAC name: 2,4-dimethyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: GFFJSTHQILQFNQ-UHFFFAOYSA-N.
| Molecular formula | C5H6ClNO2S2 |
|---|---|
| Molecular weight | 211.7 g/mol |
| IUPAC name | 2,4-dimethyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | GFFJSTHQILQFNQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)