CAS 955085-16-2 is the registry number for Dimethyl-1,3-thiazole-4-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,5-dimethyl-1,3-thiazole-4-sulfonyl chloride (CAS 955085-16-2) is a chemical compound with the molecular formula C5H6ClNO2S2 and a molecular weight of 211.7 g/mol. IUPAC name: 2,5-dimethyl-1,3-thiazole-4-sulfonyl chloride. InChIKey: SENSQPNCXAIZGY-UHFFFAOYSA-N.
| Molecular formula | C5H6ClNO2S2 |
|---|---|
| Molecular weight | 211.7 g/mol |
| IUPAC name | 2,5-dimethyl-1,3-thiazole-4-sulfonyl chloride |
| InChIKey | SENSQPNCXAIZGY-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)