CAS 1198791-56-8 appears in our catalog under these names: 6-Heptynoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-, (2R)-, 98%, 98%, (R)-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-METHYLHEPT-6-YNOIC ACID, 98%, Fmoc-α-Me-D-Gly(Pentynyl)-OH, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-ynoic acid (CAS 1198791-56-8) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-ynoic acid. InChIKey: QONJHVBQOKCHNX-HSZRJFAPSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylhept-6-ynoic acid |
| InChIKey | QONJHVBQOKCHNX-HSZRJFAPSA-N |
| SMILES | C[C@@](CCCC#C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)