CAS 119884-84-3 is the registry number for 3-Amino-5-bromo-1,3-dihydro-2h-indol-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-amino-5-bromo-1,3-dihydroindol-2-one;hydrochloride (CAS 119884-84-3) is a chemical compound with the molecular formula C8H8BrClN2O and a molecular weight of 263.52 g/mol. IUPAC name: 3-amino-5-bromo-1,3-dihydroindol-2-one;hydrochloride. InChIKey: VMCLFSHDNGCHBP-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O |
|---|---|
| Molecular weight | 263.52 g/mol |
| IUPAC name | 3-amino-5-bromo-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | VMCLFSHDNGCHBP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(C(=O)N2)N.Cl |
Computed by PubChem (NCBI)