CAS 1803588-27-3 appears in our catalog under these names: (5-Bromo-1,3-benzoxazol-2-yl)methanamine hydrochloride, 95%, (5-Bromo-1,3-benzoxazol-2-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(5-bromo-1,3-benzoxazol-2-yl)methanamine;hydrochloride (CAS 1803588-27-3) is a chemical compound with the molecular formula C8H8BrClN2O and a molecular weight of 263.52 g/mol. IUPAC name: (5-bromo-1,3-benzoxazol-2-yl)methanamine;hydrochloride. InChIKey: ANKFHVJDUXTNPA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O |
|---|---|
| Molecular weight | 263.52 g/mol |
| IUPAC name | (5-bromo-1,3-benzoxazol-2-yl)methanamine;hydrochloride |
| InChIKey | ANKFHVJDUXTNPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(O2)CN.Cl |
Computed by PubChem (NCBI)