Products 1379318-30-5
CAS 1379318-30-5 appears in our catalog under these names: 2-Amino-5-bromo-4-chloro-N-methylbenzamide, 95%, 2-Amino-5-bromo-4-chloro-N-methylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-5-bromo-4-chloro-N-methylbenzamide (CAS 1379318-30-5) is a chemical compound with the molecular formula C8H8BrClN2O and a molecular weight of 263.52 g/mol. IUPAC name: 2-amino-5-bromo-4-chloro-N-methylbenzamide. InChIKey: HPZYNJBCTHNRCZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2O |
|---|---|
| Molecular weight | 263.52 g/mol |
| IUPAC name | 2-amino-5-bromo-4-chloro-N-methylbenzamide |
| InChIKey | HPZYNJBCTHNRCZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1N)Cl)Br |
Computed by PubChem (NCBI)