CAS 1199215-99-0 is the registry number for 4B,5,6,11b-tetrahydrocyclopenta[gh]tetraphene-7,12-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Pentacyclo[10.7.1.02,7.09,20.013,18]icosa-2,4,6,9(20),13,15,17-heptaene-8,19-dione (CAS 1199215-99-0) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: pentacyclo[10.7.1.02,7.09,20.013,18]icosa-2,4,6,9(20),13,15,17-heptaene-8,19-dione. InChIKey: RPNFFALBIIRQPH-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | pentacyclo[10.7.1.02,7.09,20.013,18]icosa-2,4,6,9(20),13,15,17-heptaene-8,19-dione |
| InChIKey | RPNFFALBIIRQPH-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C1C4=CC=CC=C4C(=O)C3C5=CC=CC=C5C2=O |
Computed by PubChem (NCBI)