CAS 62940-38-9 appears in our catalog under these names: (1,1':4',1''–terphenyl)–4,4''–dicarbaldehyde, [1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, 98%, 98%, [1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, 97%, [1,1':4',1''-Terphenyl]-4,4''-dicarboxaldehyde, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100g, 100mg, 250mg, 25g.
4-[4-(4-formylphenyl)phenyl]benzaldehyde (CAS 62940-38-9) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: 4-[4-(4-formylphenyl)phenyl]benzaldehyde. InChIKey: YGHMZQVOFVDADV-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 4-[4-(4-formylphenyl)phenyl]benzaldehyde |
| InChIKey | YGHMZQVOFVDADV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)