Products 1794781-73-9
CAS 1794781-73-9 appears in our catalog under these names: Benz(a)anthracene-7-acetic Acid-13C2, Benz[a]anthracene-7-acetic Acid-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
2-benzo[a]anthracen-7-ylacetic acid (CAS 1794781-73-9) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 288.3 g/mol. IUPAC name: 2-benzo[a]anthracen-7-ylacetic acid. InChIKey: MSKUXZMLVIOBEL-HCYVGEAASA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-benzo[a]anthracen-7-ylacetic acid |
| InChIKey | MSKUXZMLVIOBEL-HCYVGEAASA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C4=CC=CC=C4C=C32)[13CH2][13C](=O)O |
Computed by PubChem (NCBI)