CAS 1199773-48-2 is the registry number for N,N-Diethyl 4-bromonaphthamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 1g, 25g, 5g.
4-bromo-N,N-diethylnaphthalene-1-carboxamide (CAS 1199773-48-2) is a chemical compound with the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. IUPAC name: 4-bromo-N,N-diethylnaphthalene-1-carboxamide. InChIKey: FVXQMTWRIJFMFB-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO |
|---|---|
| Molecular weight | 306.20 g/mol |
| IUPAC name | 4-bromo-N,N-diethylnaphthalene-1-carboxamide |
| InChIKey | FVXQMTWRIJFMFB-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C2=CC=CC=C21)Br |
Computed by PubChem (NCBI)