Products 1199773-48-2

CAS 1199773-48-2 is the registry number for N,N-Diethyl 4-bromonaphthamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-N,N-diethylnaphthalene-1-carboxamide (CAS 1199773-48-2) is a chemical compound with the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. IUPAC name: 4-bromo-N,N-diethylnaphthalene-1-carboxamide. InChIKey: FVXQMTWRIJFMFB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16BrNO
Molecular weight306.20 g/mol
IUPAC name4-bromo-N,N-diethylnaphthalene-1-carboxamide
InChIKeyFVXQMTWRIJFMFB-UHFFFAOYSA-N
SMILESCCN(CC)C(=O)C1=CC=C(C2=CC=CC=C21)Br

Computed by PubChem (NCBI)