CAS 1444336-77-9 is the registry number for 3-(Benzyloxy)-6-bromo-2,4,5-trimethylpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3,4,6-trimethyl-5-phenylmethoxypyridine (CAS 1444336-77-9) is a chemical compound with the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. IUPAC name: 2-bromo-3,4,6-trimethyl-5-phenylmethoxypyridine. InChIKey: ICOAJNSFUYXUPQ-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO |
|---|---|
| Molecular weight | 306.20 g/mol |
| IUPAC name | 2-bromo-3,4,6-trimethyl-5-phenylmethoxypyridine |
| InChIKey | ICOAJNSFUYXUPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1OCC2=CC=CC=C2)C)Br)C |
Computed by PubChem (NCBI)