CAS 1365272-69-0 is the registry number for N-t-Butyl 4-bromonaphthamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-bromo-N-tert-butylnaphthalene-1-carboxamide (CAS 1365272-69-0) is a chemical compound with the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. IUPAC name: 4-bromo-N-tert-butylnaphthalene-1-carboxamide. InChIKey: ZXJPHSBFWIQERU-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO |
|---|---|
| Molecular weight | 306.20 g/mol |
| IUPAC name | 4-bromo-N-tert-butylnaphthalene-1-carboxamide |
| InChIKey | ZXJPHSBFWIQERU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC=C(C2=CC=CC=C21)Br |
Computed by PubChem (NCBI)