CAS 120-06-9 appears in our catalog under these names: 3-Phenyl-1,2,3-oxadiazol-3-ium-5-olate, 95%, 3-Phenyl-1,2,3-oxadiazol-3-ium-5-olate, 97%, 5-Hydroxy-3-phenyl-1,2,3-oxadiazolium inner salt, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-phenyloxadiazol-3-ium-5-olate (CAS 120-06-9) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 3-phenyloxadiazol-3-ium-5-olate. InChIKey: KQEVEDHJIGSXDK-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-phenyloxadiazol-3-ium-5-olate |
| InChIKey | KQEVEDHJIGSXDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[N+]2=NOC(=C2)[O-] |
Computed by PubChem (NCBI)