Products 120-13-8
CAS 120-13-8 appears in our catalog under these names: 4–Ethoxy–3–methoxyphenylacetic acid, 4-Ethoxy-3-methoxyphenylacetic acid, 4-Ethoxy-3-methoxyphenylacetic acid 97%, 4-Ethoxy-3-methoxyphenylacetic acid, 97%, 97%, 4-Ethoxy-3-methoxyphenylacetic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 2g, 1g, 25g, 10g.
2-(4-ethoxy-3-methoxyphenyl)acetic acid (CAS 120-13-8) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(4-ethoxy-3-methoxyphenyl)acetic acid. InChIKey: XVNXRPVJRCYHEW-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(4-ethoxy-3-methoxyphenyl)acetic acid |
| InChIKey | XVNXRPVJRCYHEW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)CC(=O)O)OC |
Computed by PubChem (NCBI)