Products 1200497-79-5

CAS 1200497-79-5 is the registry number for 5-Carbamoyl-3-chloropyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-carbamoyl-3-chloropyridine-2-carboxylic acid (CAS 1200497-79-5) is a chemical compound with the molecular formula C7H5ClN2O3 and a molecular weight of 200.58 g/mol. IUPAC name: 5-carbamoyl-3-chloropyridine-2-carboxylic acid. InChIKey: FCQBJEGVSJXPRI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClN2O3
Molecular weight200.58 g/mol
IUPAC name5-carbamoyl-3-chloropyridine-2-carboxylic acid
InChIKeyFCQBJEGVSJXPRI-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)C(=O)O)C(=O)N

Computed by PubChem (NCBI)