CAS 131645-73-3 is the registry number for 2-Amino-3-nitrobenzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-amino-3-nitrobenzoyl chloride (CAS 131645-73-3) is a chemical compound with the molecular formula C7H5ClN2O3 and a molecular weight of 200.58 g/mol. IUPAC name: 2-amino-3-nitrobenzoyl chloride. InChIKey: DFCTXLDYBJXCDH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O3 |
|---|---|
| Molecular weight | 200.58 g/mol |
| IUPAC name | 2-amino-3-nitrobenzoyl chloride |
| InChIKey | DFCTXLDYBJXCDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)Cl |
Computed by PubChem (NCBI)