CAS 33512-94-6 is the registry number for Alpha-chloro-3-nitrobenzaldoxime, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
(1Z)-N-hydroxy-3-nitrobenzenecarboximidoyl chloride (CAS 33512-94-6) is a chemical compound with the molecular formula C7H5ClN2O3 and a molecular weight of 200.58 g/mol. IUPAC name: (1Z)-N-hydroxy-3-nitrobenzenecarboximidoyl chloride. InChIKey: LSAGTJSJWCRWAZ-CLFYSBASSA-N.
| Molecular formula | C7H5ClN2O3 |
|---|---|
| Molecular weight | 200.58 g/mol |
| IUPAC name | (1Z)-N-hydroxy-3-nitrobenzenecarboximidoyl chloride |
| InChIKey | LSAGTJSJWCRWAZ-CLFYSBASSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])/C(=N/O)/Cl |
Computed by PubChem (NCBI)