CAS 120118-14-1 appears in our catalog under these names: Cyazofamid Impurity 1, 4-Chloro-2-Cyano-5-(4'-Methylphenyl) Imidazole, >95% (HPLC), Cyazofamid-dessulfonamide, 4–Chlor–2–cyano–5–(4–methylphenyl)imidazol, 4-Chloro-5-(p-tolyl)-1H-imidazole-2-carbonitrile 95%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Ambeed. Available pack sizes: on request, 250mg, 500mg, 50mg, 10mg, 100mg, 1g, 25mg.
5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carbonitrile (CAS 120118-14-1) is a chemical compound with the molecular formula C11H8ClN3 and a molecular weight of 217.65 g/mol. IUPAC name: 5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carbonitrile. InChIKey: AHLIZUWPYRQFHY-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 5-chloro-4-(4-methylphenyl)-1H-imidazole-2-carbonitrile |
| InChIKey | AHLIZUWPYRQFHY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(NC(=N2)C#N)Cl |
Computed by PubChem (NCBI)