Products 331443-97-1
CAS 331443-97-1 appears in our catalog under these names: 4-Chloro-8-methyl-5h-pyrimido[5,4-b]indole, 95%, 4-Chloro-8-methyl-5H-pyrimido(5,4-b)indole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-chloro-8-methyl-5H-pyrimido[5,4-b]indole (CAS 331443-97-1) is a chemical compound with the molecular formula C11H8ClN3 and a molecular weight of 217.65 g/mol. IUPAC name: 4-chloro-8-methyl-5H-pyrimido[5,4-b]indole. InChIKey: LNQODADCKCYIRF-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 4-chloro-8-methyl-5H-pyrimido[5,4-b]indole |
| InChIKey | LNQODADCKCYIRF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2N=CN=C3Cl |
Computed by PubChem (NCBI)