CAS 161087-48-5 is the registry number for 3-Methyl-2-chloro-3H-imidazo(4,5-f)quinoline. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
2-chloro-3-methylimidazo[4,5-f]quinoline (CAS 161087-48-5) is a chemical compound with the molecular formula C11H8ClN3 and a molecular weight of 217.65 g/mol. IUPAC name: 2-chloro-3-methylimidazo[4,5-f]quinoline. InChIKey: GJOVRMBVMMUKJY-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 2-chloro-3-methylimidazo[4,5-f]quinoline |
| InChIKey | GJOVRMBVMMUKJY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C3=C(C=C2)N=CC=C3)N=C1Cl |
Computed by PubChem (NCBI)