Products 1201186-72-2
CAS 1201186-72-2 is the registry number for 1-(tert-Butyl) 3-methyl (R)-4-methylpiperazine-1,3-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-O-tert-butyl 3-O-methyl (3R)-4-methylpiperazine-1,3-dicarboxylate (CAS 1201186-72-2) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R)-4-methylpiperazine-1,3-dicarboxylate. InChIKey: CXJROCRSZVELMK-SECBINFHSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R)-4-methylpiperazine-1,3-dicarboxylate |
| InChIKey | CXJROCRSZVELMK-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)C(=O)OC)C |
Computed by PubChem (NCBI)