CAS 1201186-87-9 is the registry number for rel-(3S,4R)-1-Benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-amine (CAS 1201186-87-9) is a chemical compound with the molecular formula C17H18Cl2N2 and a molecular weight of 321.2 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-amine. InChIKey: ADKBAMYNQIJAOF-WMLDXEAASA-N.
| Molecular formula | C17H18Cl2N2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-amine |
| InChIKey | ADKBAMYNQIJAOF-WMLDXEAASA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)N)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)