Products 120975-20-4
CAS 120975-20-4 is the registry number for Delfaprazine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-chloro-2-[(2-chlorophenyl)methyl]phenyl]piperazine (CAS 120975-20-4) is a chemical compound with the molecular formula C17H18Cl2N2 and a molecular weight of 321.2 g/mol. IUPAC name: 1-[4-chloro-2-[(2-chlorophenyl)methyl]phenyl]piperazine. InChIKey: JGAPMAJNRLOLBH-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2N2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1-[4-chloro-2-[(2-chlorophenyl)methyl]phenyl]piperazine |
| InChIKey | JGAPMAJNRLOLBH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)Cl)CC3=CC=CC=C3Cl |
Computed by PubChem (NCBI)