Products 885950-04-9
CAS 885950-04-9 is the registry number for [(3,5-Dichlorophenyl)phenylmethyl]piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(3,5-dichlorophenyl)-phenylmethyl]piperazine (CAS 885950-04-9) is a chemical compound with the molecular formula C17H18Cl2N2 and a molecular weight of 321.2 g/mol. IUPAC name: 1-[(3,5-dichlorophenyl)-phenylmethyl]piperazine. InChIKey: NKUCMZXLDJSIKD-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2N2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1-[(3,5-dichlorophenyl)-phenylmethyl]piperazine |
| InChIKey | NKUCMZXLDJSIKD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(C2=CC=CC=C2)C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)