Products 1201447-05-3
CAS 1201447-05-3 appears in our catalog under these names: Ozanimod Impurity 5, Des((2-hydroxyethyl)amino) 1-Hydroxy Ozanimod. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (CAS 1201447-05-3) is a chemical compound with the molecular formula C21H19N3O3 and a molecular weight of 361.4 g/mol. IUPAC name: 5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile. InChIKey: KOBRJNRHIIDYMK-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| InChIKey | KOBRJNRHIIDYMK-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C2=NC(=NO2)C3=C4CCC(C4=CC=C3)O)C#N |
Computed by PubChem (NCBI)