Products 693265-89-3
CAS 693265-89-3 is the registry number for MDPD. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2-methoxyphenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione (CAS 693265-89-3) is a chemical compound with the molecular formula C21H19N3O3 and a molecular weight of 361.4 g/mol. IUPAC name: 6-(2-methoxyphenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione. InChIKey: MWJBSSXENNRICD-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 6-(2-methoxyphenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| InChIKey | MWJBSSXENNRICD-UHFFFAOYSA-N |
| SMILES | CN1C2=CN(C(=C2C(=O)N(C1=O)C)C3=CC=CC=C3)C4=CC=CC=C4OC |
Computed by PubChem (NCBI)