CAS 201864-70-2 appears in our catalog under these names: Fmoc-L-Pro-CHN2, Fmoc–L–Pro–CHN2, (3S)-3-FMOC-AMINO-1-DIAZO-2-BUTANONE, 95%, 95%. Offered by: Creative Peptides, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
9H-fluoren-9-ylmethyl (2S)-2-(2-diazoacetyl)pyrrolidine-1-carboxylate (CAS 201864-70-2) is a chemical compound with the molecular formula C21H19N3O3 and a molecular weight of 361.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (2S)-2-(2-diazoacetyl)pyrrolidine-1-carboxylate. InChIKey: IWVACDCSYKSLKI-IBGZPJMESA-N.
| Molecular formula | C21H19N3O3 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (2S)-2-(2-diazoacetyl)pyrrolidine-1-carboxylate |
| InChIKey | IWVACDCSYKSLKI-IBGZPJMESA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)